About methyl 13-oxotridecanoate
methyl 13-oxotridecanoate (PubChem CID 10331995) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is methyl 13-oxotridecanoate.
Molecular Properties
| Compound Name | methyl 13-oxotridecanoate |
| PubChem CID | 10331995 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | methyl 13-oxotridecanoate |
| SMILES | COC(=O)CCCCCCCCCCCC=O |
| InChI | InChI=1S/C14H26O3/c1-17-14(16)12-10-8-6-4-2-3-5-7-9-11-13-15/h13H,2-12H2,1H3 |
| InChIKey | QQPFEUUPMQPRCT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 13-oxotridecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 13-oxotridecanoate?
The IUPAC name of methyl 13-oxotridecanoate (CID 10331995) is methyl 13-oxotridecanoate.
What is the SMILES notation for methyl 13-oxotridecanoate?
The canonical SMILES for methyl 13-oxotridecanoate is COC(=O)CCCCCCCCCCCC=O.
What is the InChIKey of methyl 13-oxotridecanoate?
The InChIKey is QQPFEUUPMQPRCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-17-14(16)12-10-8-6-4-2-3-5-7-9-11-13-15/h13H,2-12H2,1H3.
What are the key properties of methyl 13-oxotridecanoate?
methyl 13-oxotridecanoate has a molecular weight of 242.36 g/mol, XLogP of 3.65, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 13-oxotridecanoate is sourced from PubChem (CID 10331995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).