C18H36N2O3 — CID 168894509
methyl 8-[2-(methylamino)ethyl-(6-oxohexyl)amino]octanoate (PubChem CID 168894509) has the molecular formula C18H36N2O3 and a molecular weight of 328.50 g/mol. Its IUPAC name is methyl 8-[2-(methylamino)ethyl-(6-oxohexyl)amino]octanoate.
| Compound Name | methyl 8-[2-(methylamino)ethyl-(6-oxohexyl)amino]octanoate |
|---|---|
| PubChem CID | 168894509 |
| Molecular Formula | C18H36N2O3 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | methyl 8-[2-(methylamino)ethyl-(6-oxohexyl)amino]octanoate |
| SMILES | CNCCN(CCCCCC=O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C18H36N2O3/c1-19-13-16-20(15-10-6-7-11-17-21)14-9-5-3-4-8-12-18(22)23-2/h17,19H,3-16H2,1-2H3 |
| InChIKey | SXKWVLSFLZXTJU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|