C23H42O5 — CID 10938183
methyl 3-[(2R,3S)-3-[2-[(4R,5R)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]oxiran-2-yl]propanoate (PubChem CID 10938183) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is methyl 3-[(2R,3S)-3-[2-[(4R,5R)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]oxiran-2-yl]propanoate.
| Compound Name | methyl 3-[(2R,3S)-3-[2-[(4R,5R)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]oxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 10938183 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | methyl 3-[(2R,3S)-3-[2-[(4R,5R)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]oxiran-2-yl]propanoate |
| SMILES | CCCCCCCCCC[C@H]1OC(C)(C)O[C@@H]1CC[C@@H]1O[C@@H]1CCC(=O)OC |
| InChI | InChI=1S/C23H42O5/c1-5-6-7-8-9-10-11-12-13-20-21(28-23(2,3)27-20)15-14-18-19(26-18)16-17-22(24)25-4/h18-21H,5-17H2,1-4H3/t18-,19+,20+,21+/m0/s1 |
| InChIKey | JAHYJIBTSJXQEG-DOIPELPJSA-N |
| XLogP | 5.54 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|