C22H40O5 — CID 14191878
methyl (E,9R)-11-[(4S,5S)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]-9-hydroxyundec-10-enoate (PubChem CID 14191878) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is methyl (E,9R)-11-[(4S,5S)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]-9-hydroxyundec-10-enoate.
| Compound Name | methyl (E,9R)-11-[(4S,5S)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]-9-hydroxyundec-10-enoate |
|---|---|
| PubChem CID | 14191878 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | methyl (E,9R)-11-[(4S,5S)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]-9-hydroxyundec-10-enoate |
| SMILES | CCCCC[C@@H]1OC(C)(C)O[C@H]1/C=C/[C@H](O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C22H40O5/c1-5-6-10-14-19-20(27-22(2,3)26-19)17-16-18(23)13-11-8-7-9-12-15-21(24)25-4/h16-20,23H,5-15H2,1-4H3/b17-16+/t18-,19+,20+/m1/s1 |
| InChIKey | GNQYZJVASBFDMV-DUYYGDEDSA-N |
| XLogP | 4.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|