C25H40O5 — CID 155000484
ethyl 4-[(4S,5R)-5-[(1E,3E,5Z,7E,9S)-9-hydroxytetradeca-1,3,5,7-tetraenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate (PubChem CID 155000484) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is ethyl 4-[(4S,5R)-5-[(1E,3E,5Z,7E,9S)-9-hydroxytetradeca-1,3,5,7-tetraenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate.
| Compound Name | ethyl 4-[(4S,5R)-5-[(1E,3E,5Z,7E,9S)-9-hydroxytetradeca-1,3,5,7-tetraenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
|---|---|
| PubChem CID | 155000484 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | ethyl 4-[(4S,5R)-5-[(1E,3E,5Z,7E,9S)-9-hydroxytetradeca-1,3,5,7-tetraenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
| SMILES | CCCCC[C@H](O)/C=C/C=C\C=C\C=C\[C@H]1OC(C)(C)O[C@H]1CCCC(=O)OCC |
| InChI | InChI=1S/C25H40O5/c1-5-7-12-16-21(26)17-13-10-8-9-11-14-18-22-23(30-25(3,4)29-22)19-15-20-24(27)28-6-2/h8-11,13-14,17-18,21-23,26H,5-7,12,15-16,19-20H2,1-4H3/b10-8-,11-9+,17-13+,18-14+/t21-,22+,23-/m0/s1 |
| InChIKey | CZRMWMQBXIZXNH-ILUWBSGXSA-N |
| XLogP | 5.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|