C24H36O6 — CID 145011369
ethyl 4-[5-[(1E,3E,5Z,7E)-9-hydroxy-9-methyltetradeca-1,3,5,7-tetraenyl]-2-oxo-1,3-dioxolan-4-yl]butanoate (PubChem CID 145011369) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is ethyl 4-[5-[(1E,3E,5Z,7E)-9-hydroxy-9-methyltetradeca-1,3,5,7-tetraenyl]-2-oxo-1,3-dioxolan-4-yl]butanoate.
| Compound Name | ethyl 4-[5-[(1E,3E,5Z,7E)-9-hydroxy-9-methyltetradeca-1,3,5,7-tetraenyl]-2-oxo-1,3-dioxolan-4-yl]butanoate |
|---|---|
| PubChem CID | 145011369 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | ethyl 4-[5-[(1E,3E,5Z,7E)-9-hydroxy-9-methyltetradeca-1,3,5,7-tetraenyl]-2-oxo-1,3-dioxolan-4-yl]butanoate |
| SMILES | CCCCCC(C)(O)/C=C/C=C\C=C\C=C\C1OC(=O)OC1CCCC(=O)OCC |
| InChI | InChI=1S/C24H36O6/c1-4-6-12-18-24(3,27)19-13-10-8-7-9-11-15-20-21(30-23(26)29-20)16-14-17-22(25)28-5-2/h7-11,13,15,19-21,27H,4-6,12,14,16-18H2,1-3H3/b9-7+,10-8-,15-11+,19-13+ |
| InChIKey | LCMYCCUZZWFIMZ-LDQCHXKOSA-N |
| XLogP | 5.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|