C20H30O8 — CID 70601405
cis-(1R,3R)-1-(2-ethoxy-2-oxoethyl)-5-(3-hydroxy-3-methyloct-1-enyl)-2-oxocyclopentane-1,3-dicarboxylic acid (PubChem CID 70601405) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is cis-(1R,3R)-1-(2-ethoxy-2-oxoethyl)-5-(3-hydroxy-3-methyloct-1-enyl)-2-oxocyclopentane-1,3-dicarboxylic acid.
| Compound Name | cis-(1R,3R)-1-(2-ethoxy-2-oxoethyl)-5-(3-hydroxy-3-methyloct-1-enyl)-2-oxocyclopentane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 70601405 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | cis-(1R,3R)-1-(2-ethoxy-2-oxoethyl)-5-(3-hydroxy-3-methyloct-1-enyl)-2-oxocyclopentane-1,3-dicarboxylic acid |
| SMILES | CCCCCC(C)(O)C=CC1C[C@@H](C(=O)O)C(=O)[C@]1(CC(=O)OCC)C(=O)O |
| InChI | InChI=1S/C20H30O8/c1-4-6-7-9-19(3,27)10-8-13-11-14(17(23)24)16(22)20(13,18(25)26)12-15(21)28-5-2/h8,10,13-14,27H,4-7,9,11-12H2,1-3H3,(H,23,24)(H,25,26)/t13?,14-,19?,20-/m1/s1 |
| InChIKey | KNAQFQAHLRUAHJ-BANHHRGYSA-N |
| XLogP | 2.19 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|