C22H34O5 — CID 70573692
cis-(1R,2R)-2-[(Z)-4-[(1R,2R,5S)-5-hydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]-3-oxocyclopentyl]but-2-enyl]cyclopropane-1-carboxylic acid (PubChem CID 70573692) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is cis-(1R,2R)-2-[(Z)-4-[(1R,2R,5S)-5-hydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]-3-oxocyclopentyl]but-2-enyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,2R)-2-[(Z)-4-[(1R,2R,5S)-5-hydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]-3-oxocyclopentyl]but-2-enyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70573692 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | cis-(1R,2R)-2-[(Z)-4-[(1R,2R,5S)-5-hydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]-3-oxocyclopentyl]but-2-enyl]cyclopropane-1-carboxylic acid |
| SMILES | CCCCC[C@@](C)(O)/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C\C[C@@H]1C[C@H]1C(=O)O |
| InChI | InChI=1S/C22H34O5/c1-3-4-7-11-22(2,27)12-10-17-16(19(23)14-20(17)24)9-6-5-8-15-13-18(15)21(25)26/h5-6,10,12,15-19,23,27H,3-4,7-9,11,13-14H2,1-2H3,(H,25,26)/b6-5-,12-10+/t15-,16-,17-,18-,19+,22-/m1/s1 |
| InChIKey | WHZNXKSHSBALJT-GCUVMTEGSA-N |
| XLogP | 3.50 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|