C24H38O5 — CID 56979465
7-[(1R,2R,5S)-2-(4-cyclopropyl-4-hydroxynon-1-enyl)-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 56979465) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-(4-cyclopropyl-4-hydroxynon-1-enyl)-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-(4-cyclopropyl-4-hydroxynon-1-enyl)-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 56979465 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 7-[(1R,2R,5S)-2-(4-cyclopropyl-4-hydroxynon-1-enyl)-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(O)(CC=C[C@H]1C(=O)C[C@H](O)[C@@H]1CC=CCCCC(=O)O)C1CC1 |
| InChI | InChI=1S/C24H38O5/c1-2-3-8-15-24(29,18-13-14-18)16-9-11-20-19(21(25)17-22(20)26)10-6-4-5-7-12-23(27)28/h4,6,9,11,18-21,25,29H,2-3,5,7-8,10,12-17H2,1H3,(H,27,28)/t19-,20-,21+,24?/m1/s1 |
| InChIKey | WOOFTSQRMFQYSM-IOTXOVQSSA-N |
| XLogP | 4.42 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|