C25H42O4 — CID 57089272
(2R,3R,4R)-3-(4-cyclopropyl-4-hydroxydec-1-enyl)-4-hydroxy-2-(7-hydroxyhept-2-enyl)cyclopentan-1-one (PubChem CID 57089272) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is (2R,3R,4R)-3-(4-cyclopropyl-4-hydroxydec-1-enyl)-4-hydroxy-2-(7-hydroxyhept-2-enyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-(4-cyclopropyl-4-hydroxydec-1-enyl)-4-hydroxy-2-(7-hydroxyhept-2-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 57089272 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | (2R,3R,4R)-3-(4-cyclopropyl-4-hydroxydec-1-enyl)-4-hydroxy-2-(7-hydroxyhept-2-enyl)cyclopentan-1-one |
| SMILES | CCCCCCC(O)(CC=C[C@H]1[C@H](O)CC(=O)[C@@H]1CC=CCCCCO)C1CC1 |
| InChI | InChI=1S/C25H42O4/c1-2-3-4-9-16-25(29,20-14-15-20)17-11-13-22-21(23(27)19-24(22)28)12-8-6-5-7-10-18-26/h6,8,11,13,20-22,24,26,28-29H,2-5,7,9-10,12,14-19H2,1H3/t21-,22-,24-,25?/m1/s1 |
| InChIKey | HYAQAYYGJHGOHD-HVIZWMAQSA-N |
| XLogP | 4.72 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|