C22H34O5 — CID 70596024
(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyl-5-methylideneoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70596024) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyl-5-methylideneoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyl-5-methylideneoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70596024 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyl-5-methylideneoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | C=C(CCC)C(C)(O)C/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C22H34O5/c1-4-10-16(2)22(3,27)14-9-12-18-17(19(23)15-20(18)24)11-7-5-6-8-13-21(25)26/h5,7,9,12,17-18,20,24,27H,2,4,6,8,10-11,13-15H2,1,3H3,(H,25,26)/b7-5-,12-9+/t17-,18-,20-,22?/m1/s1 |
| InChIKey | BWINPYVFUCORNR-ODTIHRNFSA-N |
| XLogP | 3.81 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|