C23H36O5 — CID 70537131
(2R,3R,4R)-3-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]-4-hydroxy-2-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopentan-1-one (PubChem CID 70537131) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is (2R,3R,4R)-3-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]-4-hydroxy-2-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]-4-hydroxy-2-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 70537131 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (2R,3R,4R)-3-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]-4-hydroxy-2-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopentan-1-one |
| SMILES | C=CC(O)(C/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)CO)CCCC |
| InChI | InChI=1S/C23H36O5/c1-3-5-14-23(28,4-2)15-10-13-20-19(21(26)16-22(20)27)12-9-7-6-8-11-18(25)17-24/h4,7,9-10,13,19-20,22,24,27-28H,2-3,5-6,8,11-12,14-17H2,1H3/b9-7-,13-10+/t19-,20-,22-,23?/m1/s1 |
| InChIKey | XFVGLKGNRNGKQK-IKTUROQDSA-N |
| XLogP | 3.28 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|