C25H38O6 — CID 56992567
ethyl 8-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxy-4-methyl-5-methylideneoct-1-enyl)-5-oxocyclopentyl]-2-oxooct-6-enoate (PubChem CID 56992567) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is ethyl 8-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxy-4-methyl-5-methylideneoct-1-enyl)-5-oxocyclopentyl]-2-oxooct-6-enoate.
| Compound Name | ethyl 8-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxy-4-methyl-5-methylideneoct-1-enyl)-5-oxocyclopentyl]-2-oxooct-6-enoate |
|---|---|
| PubChem CID | 56992567 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | ethyl 8-[(1R,2R,3R)-3-hydroxy-2-(4-hydroxy-4-methyl-5-methylideneoct-1-enyl)-5-oxocyclopentyl]-2-oxooct-6-enoate |
| SMILES | C=C(CCC)C(C)(O)CC=C[C@H]1[C@H](O)CC(=O)[C@@H]1CC=CCCCC(=O)C(=O)OCC |
| InChI | InChI=1S/C25H38O6/c1-5-12-18(3)25(4,30)16-11-14-20-19(22(27)17-23(20)28)13-9-7-8-10-15-21(26)24(29)31-6-2/h7,9,11,14,19-20,23,28,30H,3,5-6,8,10,12-13,15-17H2,1-2,4H3/t19-,20-,23-,25?/m1/s1 |
| InChIKey | WVYUEFWEZIWFNK-HDNBMYSKSA-N |
| XLogP | 3.85 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|