C27H46O5 — CID 70432494
3-[(Z)-4-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]but-2-enyl]nonanoic acid (PubChem CID 70432494) has the molecular formula C27H46O5 and a molecular weight of 450.66 g/mol. Its IUPAC name is 3-[(Z)-4-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]but-2-enyl]nonanoic acid.
| Compound Name | 3-[(Z)-4-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]but-2-enyl]nonanoic acid |
|---|---|
| PubChem CID | 70432494 |
| Molecular Formula | C27H46O5 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | 3-[(Z)-4-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]but-2-enyl]nonanoic acid |
| SMILES | CCCCCCC(C/C=C\C[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/CC(C)(O)CCCC)CC(=O)O |
| InChI | InChI=1S/C27H46O5/c1-4-6-8-9-13-21(19-26(30)31)14-10-11-15-22-23(25(29)20-24(22)28)16-12-18-27(3,32)17-7-5-2/h10-12,16,21-23,25,29,32H,4-9,13-15,17-20H2,1-3H3,(H,30,31)/b11-10-,16-12+/t21?,22-,23-,25-,27?/m1/s1 |
| InChIKey | JYMPEJBXITWXTM-HWAWIGQKSA-N |
| XLogP | 5.84 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|