C22H38O4 — CID 59986854
(2R,3R,4R)-4-hydroxy-3-[(E,4R)-4-hydroxy-4-methyloct-1-enyl]-2-(7-oxooctyl)cyclopentan-1-one (PubChem CID 59986854) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is (2R,3R,4R)-4-hydroxy-3-[(E,4R)-4-hydroxy-4-methyloct-1-enyl]-2-(7-oxooctyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-hydroxy-3-[(E,4R)-4-hydroxy-4-methyloct-1-enyl]-2-(7-oxooctyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 59986854 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | (2R,3R,4R)-4-hydroxy-3-[(E,4R)-4-hydroxy-4-methyloct-1-enyl]-2-(7-oxooctyl)cyclopentan-1-one |
| SMILES | CCCC[C@@](C)(O)C/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(C)=O |
| InChI | InChI=1S/C22H38O4/c1-4-5-14-22(3,26)15-10-13-19-18(20(24)16-21(19)25)12-9-7-6-8-11-17(2)23/h10,13,18-19,21,25-26H,4-9,11-12,14-16H2,1-3H3/b13-10+/t18-,19-,21-,22-/m1/s1 |
| InChIKey | UNHBGDGJCPFZDH-YXOLFMHCSA-N |
| XLogP | 4.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|