C23H40O7 — CID 54154423
7-[(1R,2R,3R)-2-[4-(dimethoxymethyl)-4-hydroxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 54154423) has the molecular formula C23H40O7 and a molecular weight of 428.57 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[4-(dimethoxymethyl)-4-hydroxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[4-(dimethoxymethyl)-4-hydroxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54154423 |
| Molecular Formula | C23H40O7 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[4-(dimethoxymethyl)-4-hydroxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCC(O)(CC=C[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)O)C(OC)OC |
| InChI | InChI=1S/C23H40O7/c1-4-5-14-23(28,22(29-2)30-3)15-10-12-18-17(19(24)16-20(18)25)11-8-6-7-9-13-21(26)27/h10,12,17-18,20,22,25,28H,4-9,11,13-16H2,1-3H3,(H,26,27)/t17-,18-,20-,23?/m1/s1 |
| InChIKey | OKABKCPEWMLQNJ-KLIPWLBKSA-N |
| XLogP | 3.46 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|