C22H38O6 — CID 57309465
7-[(1R,2R)-3-hydroxy-2-[(3R,4R)-3-hydroxy-4-methoxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 57309465) has the molecular formula C22H38O6 and a molecular weight of 398.54 g/mol. Its IUPAC name is 7-[(1R,2R)-3-hydroxy-2-[(3R,4R)-3-hydroxy-4-methoxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R)-3-hydroxy-2-[(3R,4R)-3-hydroxy-4-methoxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 57309465 |
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 7-[(1R,2R)-3-hydroxy-2-[(3R,4R)-3-hydroxy-4-methoxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCC[C@@](C)(OC)[C@H](O)C=C[C@H]1C(O)CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H38O6/c1-4-5-14-22(2,28-3)20(25)13-12-17-16(18(23)15-19(17)24)10-8-6-7-9-11-21(26)27/h12-13,16-17,19-20,24-25H,4-11,14-15H2,1-3H3,(H,26,27)/t16-,17-,19?,20-,22-/m1/s1 |
| InChIKey | IKYLGIKGFLQZBD-ICDGHDBKSA-N |
| XLogP | 3.49 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|