C22H40O4 — CID 57255802
(2R,3R,4R)-2-heptyl-4-hydroxy-3-[(3R,4R)-3-hydroxy-4-methoxy-4-methyloct-1-enyl]cyclopentan-1-one (PubChem CID 57255802) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is (2R,3R,4R)-2-heptyl-4-hydroxy-3-[(3R,4R)-3-hydroxy-4-methoxy-4-methyloct-1-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-2-heptyl-4-hydroxy-3-[(3R,4R)-3-hydroxy-4-methoxy-4-methyloct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 57255802 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | (2R,3R,4R)-2-heptyl-4-hydroxy-3-[(3R,4R)-3-hydroxy-4-methoxy-4-methyloct-1-enyl]cyclopentan-1-one |
| SMILES | CCCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1C=C[C@@H](O)[C@@](C)(CCCC)OC |
| InChI | InChI=1S/C22H40O4/c1-5-7-9-10-11-12-17-18(20(24)16-19(17)23)13-14-21(25)22(3,26-4)15-8-6-2/h13-14,17-18,20-21,24-25H,5-12,15-16H2,1-4H3/t17-,18-,20-,21-,22-/m1/s1 |
| InChIKey | GEVVDBWYPDSYDP-ISMARYCFSA-N |
| XLogP | 4.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|