C22H34O5 — CID 88769144
(2R,3R,4R)-3-(4-ethynyl-4-hydroxyhept-1-enyl)-4-hydroxy-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one (PubChem CID 88769144) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (2R,3R,4R)-3-(4-ethynyl-4-hydroxyhept-1-enyl)-4-hydroxy-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-(4-ethynyl-4-hydroxyhept-1-enyl)-4-hydroxy-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 88769144 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (2R,3R,4R)-3-(4-ethynyl-4-hydroxyhept-1-enyl)-4-hydroxy-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one |
| SMILES | C#CC(O)(CC=C[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)CO)CCC |
| InChI | InChI=1S/C22H34O5/c1-3-13-22(27,4-2)14-9-12-19-18(20(25)15-21(19)26)11-8-6-5-7-10-17(24)16-23/h2,9,12,18-19,21,23,26-27H,3,5-8,10-11,13-16H2,1H3/t18-,19-,21-,22?/m1/s1 |
| InChIKey | RCRQGEMYYGQMBX-IGVHTGPWSA-N |
| XLogP | 2.57 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|