C21H35BrO4 — CID 70464779
(Z)-7-[(1R,2R,3R,5R)-5-bromo-3-hydroxy-2-[(E)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 70464779) has the molecular formula C21H35BrO4 and a molecular weight of 431.41 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5R)-5-bromo-3-hydroxy-2-[(E)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5R)-5-bromo-3-hydroxy-2-[(E)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70464779 |
| Molecular Formula | C21H35BrO4 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5R)-5-bromo-3-hydroxy-2-[(E)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(C)(O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H](Br)C[C@H]1O |
| InChI | InChI=1S/C21H35BrO4/c1-3-4-9-13-21(2,26)14-12-17-16(18(22)15-19(17)23)10-7-5-6-8-11-20(24)25/h5,7,12,14,16-19,23,26H,3-4,6,8-11,13,15H2,1-2H3,(H,24,25)/b7-5-,14-12+/t16-,17-,18-,19-,21?/m1/s1 |
| InChIKey | AWAZFZGGSSQADO-FNEMIHNCSA-N |
| XLogP | 4.84 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|