C22H33NO4 — CID 70610015
(E)-7-[(3S)-3-cyano-2-[(E)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70610015) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is (E)-7-[(3S)-3-cyano-2-[(E)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(3S)-3-cyano-2-[(E)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70610015 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (E)-7-[(3S)-3-cyano-2-[(E)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(C)(O)/C=C/C1C(C/C=C/CCCC(=O)O)C(=O)C[C@@H]1C#N |
| InChI | InChI=1S/C22H33NO4/c1-3-4-9-13-22(2,27)14-12-18-17(16-23)15-20(24)19(18)10-7-5-6-8-11-21(25)26/h5,7,12,14,17-19,27H,3-4,6,8-11,13,15H2,1-2H3,(H,25,26)/b7-5+,14-12+/t17-,18?,19?,22?/m1/s1 |
| InChIKey | KVSWQSGQTGCDRT-RFLGVISVSA-N |
| XLogP | 4.42 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|