C21H36O4 — CID 54269454
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-non-1-enylcyclopentyl]hept-5-enoic acid (PubChem CID 54269454) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-non-1-enylcyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-non-1-enylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54269454 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-non-1-enylcyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCCCC=C[C@@H]1[C@@H](CC=CCCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C21H36O4/c1-2-3-4-5-6-7-10-13-17-18(20(23)16-19(17)22)14-11-8-9-12-15-21(24)25/h8,10-11,13,17-20,22-23H,2-7,9,12,14-16H2,1H3,(H,24,25)/t17-,18-,19-,20+/m1/s1 |
| InChIKey | RJCVOANHHSSKSJ-WTGUMLROSA-N |
| XLogP | 4.46 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|