C22H38O4 — CID 70598644
ethyl (Z)-7-[(1R,2R,3R,5R)-3,5-dihydroxy-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 70598644) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is ethyl (Z)-7-[(1R,2R,3R,5R)-3,5-dihydroxy-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | ethyl (Z)-7-[(1R,2R,3R,5R)-3,5-dihydroxy-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70598644 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | ethyl (Z)-7-[(1R,2R,3R,5R)-3,5-dihydroxy-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OCC)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H38O4/c1-3-5-6-7-8-11-14-18-19(21(24)17-20(18)23)15-12-9-10-13-16-22(25)26-4-2/h9,11-12,14,18-21,23-24H,3-8,10,13,15-17H2,1-2H3/b12-9-,14-11+/t18-,19-,20-,21-/m1/s1 |
| InChIKey | AMRHYYUYESOHAK-JRKCBQGMSA-N |
| XLogP | 4.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|