C30H54O5 — CID 57252123
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enyl decanoate (PubChem CID 57252123) has the molecular formula C30H54O5 and a molecular weight of 494.76 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enyl decanoate.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enyl decanoate |
|---|---|
| PubChem CID | 57252123 |
| Molecular Formula | C30H54O5 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.40 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCCCCC=CC[C@@H]1[C@@H](C=C[C@@H](O)CCCCC)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C30H54O5/c1-3-5-7-8-9-12-16-20-30(34)35-23-17-13-10-11-15-19-26-27(29(33)24-28(26)32)22-21-25(31)18-14-6-4-2/h11,15,21-22,25-29,31-33H,3-10,12-14,16-20,23-24H2,1-2H3/t25-,26+,27+,28-,29+/m0/s1 |
| InChIKey | GRDXDAKBYOSFEF-MLZSXWJDSA-N |
| XLogP | 6.64 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|