C25H42O8 — CID 157005025
[(2S)-3-acetyloxy-2-hydroxypropyl] (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 157005025) has the molecular formula C25H42O8 and a molecular weight of 470.60 g/mol. Its IUPAC name is [(2S)-3-acetyloxy-2-hydroxypropyl] (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | [(2S)-3-acetyloxy-2-hydroxypropyl] (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 157005025 |
| Molecular Formula | C25H42O8 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | [(2S)-3-acetyloxy-2-hydroxypropyl] (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C/CCCC(=O)OC[C@@H](O)COC(C)=O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C25H42O8/c1-3-4-7-10-19(27)13-14-22-21(23(29)15-24(22)30)11-8-5-6-9-12-25(31)33-17-20(28)16-32-18(2)26/h5,8,13-14,19-24,27-30H,3-4,6-7,9-12,15-17H2,1-2H3/b8-5+,14-13+/t19-,20-,21+,22+,23-,24+/m0/s1 |
| InChIKey | JXYJWJWQCKNXKK-VGIZRWFNSA-N |
| XLogP | 2.43 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|