C25H43O11P — CID 156969868
[(2R)-2-acetyloxy-3-phosphonooxypropyl] (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 156969868) has the molecular formula C25H43O11P and a molecular weight of 550.58 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-phosphonooxypropyl] (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | [(2R)-2-acetyloxy-3-phosphonooxypropyl] (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 156969868 |
| Molecular Formula | C25H43O11P |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | [(2R)-2-acetyloxy-3-phosphonooxypropyl] (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C/CCCC(=O)OC[C@H](COP(=O)(O)O)OC(C)=O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C25H43O11P/c1-3-4-7-10-19(27)13-14-22-21(23(28)15-24(22)29)11-8-5-6-9-12-25(30)34-16-20(36-18(2)26)17-35-37(31,32)33/h5,8,13-14,19-24,27-29H,3-4,6-7,9-12,15-17H2,1-2H3,(H2,31,32,33)/b8-5+,14-13+/t19-,20+,21+,22+,23-,24+/m0/s1 |
| InChIKey | MHRHXCYMOIHFMG-KOAXEJKKSA-N |
| XLogP | 2.54 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|