C26H44O5 — CID 70634894
ethyl (Z)-3-ethyl-7-[(1R,2R,5S)-2-[(E,3R)-3-ethyl-3-hydroxyoct-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoate (PubChem CID 70634894) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is ethyl (Z)-3-ethyl-7-[(1R,2R,5S)-2-[(E,3R)-3-ethyl-3-hydroxyoct-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoate.
| Compound Name | ethyl (Z)-3-ethyl-7-[(1R,2R,5S)-2-[(E,3R)-3-ethyl-3-hydroxyoct-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70634894 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | ethyl (Z)-3-ethyl-7-[(1R,2R,5S)-2-[(E,3R)-3-ethyl-3-hydroxyoct-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@@](O)(/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C\CC(CC)CC(=O)OCC)CC |
| InChI | InChI=1S/C26H44O5/c1-5-9-12-16-26(30,7-3)17-15-22-21(23(27)19-24(22)28)14-11-10-13-20(6-2)18-25(29)31-8-4/h10-11,15,17,20-23,27,30H,5-9,12-14,16,18-19H2,1-4H3/b11-10-,17-15+/t20?,21-,22-,23+,26-/m1/s1 |
| InChIKey | JNCAOPXVJOJNAX-IQHXKCLSSA-N |
| XLogP | 5.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|