C14H28O2 — CID 22223420
(E)-5,8-dimethyldodec-6-ene-5,8-diol (PubChem CID 22223420) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is (E)-5,8-dimethyldodec-6-ene-5,8-diol.
| Compound Name | (E)-5,8-dimethyldodec-6-ene-5,8-diol |
|---|---|
| PubChem CID | 22223420 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (E)-5,8-dimethyldodec-6-ene-5,8-diol |
| SMILES | CCCCC(C)(O)/C=C/C(C)(O)CCCC |
| InChI | InChI=1S/C14H28O2/c1-5-7-9-13(3,15)11-12-14(4,16)10-8-6-2/h11-12,15-16H,5-10H2,1-4H3/b12-11+ |
| InChIKey | YIYGRCCOXKICMN-VAWYXSNFSA-N |
| XLogP | 3.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|