C16H36 — CID 169424592
2,2-dimethylhexane (PubChem CID 169424592) has the molecular formula C16H36 and a molecular weight of 228.46 g/mol. Its IUPAC name is 2,2-dimethylhexane.
| Compound Name | 2,2-dimethylhexane |
|---|---|
| PubChem CID | 169424592 |
| Molecular Formula | C16H36 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.28 |
| IUPAC Name | 2,2-dimethylhexane |
| SMILES | CCCCC(C)(C)C.CCCCC(C)(C)C |
| InChI | InChI=1S/2C8H18/c2*1-5-6-7-8(2,3)4/h2*5-7H2,1-4H3 |
| InChIKey | CXFSIRLUWWQCGB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |