2,2-dimethylhexane;2-methylpropanoic acid

C12H26O2 — CID 159057066

IUPAC2,2-dimethylhexane;2-methylpropanoic acid
SMILESCC(C)C(=O)O.CCCCC(C)(C)C
InChIInChI=1S/C8H18.C4H8O2/c1-5-6-7-8(2,3)4;1-3(2)4(5)6/h5-7H2,1-4H3;3H,1-2H3,(H,5,6)
InChIKeyJXZKCCANZOHHED-UHFFFAOYSA-N
MW202.34 g/mol
LogP3.95
Rot. Bonds3

About 2,2-dimethylhexane;2-methylpropanoic acid

2,2-dimethylhexane;2-methylpropanoic acid (PubChem CID 159057066) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 2,2-dimethylhexane;2-methylpropanoic acid.

Molecular Properties

Compound Name2,2-dimethylhexane;2-methylpropanoic acid
PubChem CID159057066
Molecular FormulaC12H26O2
Molecular Weight202.34 g/mol
Exact Mass202.19
IUPAC Name2,2-dimethylhexane;2-methylpropanoic acid
SMILESCC(C)C(=O)O.CCCCC(C)(C)C
InChIInChI=1S/C8H18.C4H8O2/c1-5-6-7-8(2,3)4;1-3(2)4(5)6/h5-7H2,1-4H3;3H,1-2H3,(H,5,6)
InChIKeyJXZKCCANZOHHED-UHFFFAOYSA-N
XLogP3.95
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.34
LogP ≤ 53.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,2-dimethylhexane;2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethylhexane;2-methylpropanoic acid?
The IUPAC name of 2,2-dimethylhexane;2-methylpropanoic acid (CID 159057066) is 2,2-dimethylhexane;2-methylpropanoic acid.
What is the SMILES notation for 2,2-dimethylhexane;2-methylpropanoic acid?
The canonical SMILES for 2,2-dimethylhexane;2-methylpropanoic acid is CC(C)C(=O)O.CCCCC(C)(C)C.
What is the InChIKey of 2,2-dimethylhexane;2-methylpropanoic acid?
The InChIKey is JXZKCCANZOHHED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C4H8O2/c1-5-6-7-8(2,3)4;1-3(2)4(5)6/h5-7H2,1-4H3;3H,1-2H3,(H,5,6).
What are the key properties of 2,2-dimethylhexane;2-methylpropanoic acid?
2,2-dimethylhexane;2-methylpropanoic acid has a molecular weight of 202.34 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylhexane;2-methylpropanoic acid is sourced from PubChem (CID 159057066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).