C14H32O3 — CID 175103669
2,2-dimethylhexane;ethanol;2-methylpropanoic acid (PubChem CID 175103669) has the molecular formula C14H32O3 and a molecular weight of 248.41 g/mol. Its IUPAC name is 2,2-dimethylhexane;ethanol;2-methylpropanoic acid.
| Compound Name | 2,2-dimethylhexane;ethanol;2-methylpropanoic acid |
|---|---|
| PubChem CID | 175103669 |
| Molecular Formula | C14H32O3 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.24 |
| IUPAC Name | 2,2-dimethylhexane;ethanol;2-methylpropanoic acid |
| SMILES | CC(C)C(=O)O.CCCCC(C)(C)C.CCO |
| InChI | InChI=1S/C8H18.C4H8O2.C2H6O/c1-5-6-7-8(2,3)4;1-3(2)4(5)6;1-2-3/h5-7H2,1-4H3;3H,1-2H3,(H,5,6);3H,2H2,1H3 |
| InChIKey | IHYWKTZKMVYNNX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |