C23H53NO2P+ — CID 174553158
azane;7,7-dimethyloctanoic acid;tributyl(methyl)phosphanium (PubChem CID 174553158) has the molecular formula C23H53NO2P+ and a molecular weight of 406.66 g/mol. Its IUPAC name is azane;7,7-dimethyloctanoic acid;tributyl(methyl)phosphanium.
| Compound Name | azane;7,7-dimethyloctanoic acid;tributyl(methyl)phosphanium |
|---|---|
| PubChem CID | 174553158 |
| Molecular Formula | C23H53NO2P+ |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.38 |
| IUPAC Name | azane;7,7-dimethyloctanoic acid;tributyl(methyl)phosphanium |
| SMILES | CC(C)(C)CCCCCC(=O)O.CCCC[P+](C)(CCCC)CCCC.N |
| InChI | InChI=1S/C13H30P.C10H20O2.H3N/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-10(2,3)8-6-4-5-7-9(11)12;/h5-13H2,1-4H3;4-8H2,1-3H3,(H,11,12);1H3/q+1;; |
| InChIKey | NFLBVJACHVOCKS-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|