C19H38FeO4 — CID 56841408
6,6-dimethylheptanoic acid;7,7-dimethyloctanoic acid;iron (PubChem CID 56841408) has the molecular formula C19H38FeO4 and a molecular weight of 386.35 g/mol. Its IUPAC name is 6,6-dimethylheptanoic acid;7,7-dimethyloctanoic acid;iron.
| Compound Name | 6,6-dimethylheptanoic acid;7,7-dimethyloctanoic acid;iron |
|---|---|
| PubChem CID | 56841408 |
| Molecular Formula | C19H38FeO4 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 6,6-dimethylheptanoic acid;7,7-dimethyloctanoic acid;iron |
| SMILES | CC(C)(C)CCCCC(=O)O.CC(C)(C)CCCCCC(=O)O.[Fe] |
| InChI | InChI=1S/C10H20O2.C9H18O2.Fe/c1-10(2,3)8-6-4-5-7-9(11)12;1-9(2,3)7-5-4-6-8(10)11;/h4-8H2,1-3H3,(H,11,12);4-7H2,1-3H3,(H,10,11); |
| InChIKey | MQRACIZSDZZLOU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|