C20H40O4Zn — CID 56844104
6,6-dimethylheptanoic acid;8,8-dimethylnonanoic acid;zinc (PubChem CID 56844104) has the molecular formula C20H40O4Zn and a molecular weight of 409.93 g/mol. Its IUPAC name is 6,6-dimethylheptanoic acid;8,8-dimethylnonanoic acid;zinc.
| Compound Name | 6,6-dimethylheptanoic acid;8,8-dimethylnonanoic acid;zinc |
|---|---|
| PubChem CID | 56844104 |
| Molecular Formula | C20H40O4Zn |
| Molecular Weight | 409.93 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 6,6-dimethylheptanoic acid;8,8-dimethylnonanoic acid;zinc |
| SMILES | CC(C)(C)CCCCC(=O)O.CC(C)(C)CCCCCCC(=O)O.[Zn] |
| InChI | InChI=1S/C11H22O2.C9H18O2.Zn/c1-11(2,3)9-7-5-4-6-8-10(12)13;1-9(2,3)7-5-4-6-8(10)11;/h4-9H2,1-3H3,(H,12,13);4-7H2,1-3H3,(H,10,11); |
| InChIKey | XLJFROBAZONGPW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.93 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|