C19H38CoO4 — CID 170845955
cobalt;7,7-dimethyloctanoic acid;7-methyloctanoic acid (PubChem CID 170845955) has the molecular formula C19H38CoO4 and a molecular weight of 389.44 g/mol. Its IUPAC name is cobalt;7,7-dimethyloctanoic acid;7-methyloctanoic acid.
| Compound Name | cobalt;7,7-dimethyloctanoic acid;7-methyloctanoic acid |
|---|---|
| PubChem CID | 170845955 |
| Molecular Formula | C19H38CoO4 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | cobalt;7,7-dimethyloctanoic acid;7-methyloctanoic acid |
| SMILES | CC(C)(C)CCCCCC(=O)O.CC(C)CCCCCC(=O)O.[Co] |
| InChI | InChI=1S/C10H20O2.C9H18O2.Co/c1-10(2,3)8-6-4-5-7-9(11)12;1-8(2)6-4-3-5-7-9(10)11;/h4-8H2,1-3H3,(H,11,12);8H,3-7H2,1-2H3,(H,10,11); |
| InChIKey | JIWQWZZQAXHWON-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|