C18H36CuO4 — CID 91844645
copper;7,7-dimethyloctanoic acid;6-methylheptanoic acid (PubChem CID 91844645) has the molecular formula C18H36CuO4 and a molecular weight of 380.03 g/mol. Its IUPAC name is copper;7,7-dimethyloctanoic acid;6-methylheptanoic acid.
| Compound Name | copper;7,7-dimethyloctanoic acid;6-methylheptanoic acid |
|---|---|
| PubChem CID | 91844645 |
| Molecular Formula | C18H36CuO4 |
| Molecular Weight | 380.03 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | copper;7,7-dimethyloctanoic acid;6-methylheptanoic acid |
| SMILES | CC(C)(C)CCCCCC(=O)O.CC(C)CCCCC(=O)O.[Cu] |
| InChI | InChI=1S/C10H20O2.C8H16O2.Cu/c1-10(2,3)8-6-4-5-7-9(11)12;1-7(2)5-3-4-6-8(9)10;/h4-8H2,1-3H3,(H,11,12);7H,3-6H2,1-2H3,(H,9,10); |
| InChIKey | PNTNPQYEWJGRMC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.03 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|