C22H32O6 — CID 134275844
methyl 4-[(5R)-5-[(E)-2-(2-hexanoylfuran-3-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate (PubChem CID 134275844) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is methyl 4-[(5R)-5-[(E)-2-(2-hexanoylfuran-3-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate.
| Compound Name | methyl 4-[(5R)-5-[(E)-2-(2-hexanoylfuran-3-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
|---|---|
| PubChem CID | 134275844 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | methyl 4-[(5R)-5-[(E)-2-(2-hexanoylfuran-3-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
| SMILES | CCCCCC(=O)c1occc1/C=C/[C@H]1OC(C)(C)OC1CCCC(=O)OC |
| InChI | InChI=1S/C22H32O6/c1-5-6-7-9-17(23)21-16(14-15-26-21)12-13-19-18(27-22(2,3)28-19)10-8-11-20(24)25-4/h12-15,18-19H,5-11H2,1-4H3/b13-12+/t18?,19-/m1/s1 |
| InChIKey | SKOLBGQVUPNRDB-WYZPZLPRSA-N |
| XLogP | 4.92 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|