C27H35NO6 — CID 134275807
methyl 4-[5-[(E)-2-(4-hexanoyl-2-phenyl-1,3-oxazol-5-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate (PubChem CID 134275807) has the molecular formula C27H35NO6 and a molecular weight of 469.58 g/mol. Its IUPAC name is methyl 4-[5-[(E)-2-(4-hexanoyl-2-phenyl-1,3-oxazol-5-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate.
| Compound Name | methyl 4-[5-[(E)-2-(4-hexanoyl-2-phenyl-1,3-oxazol-5-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
|---|---|
| PubChem CID | 134275807 |
| Molecular Formula | C27H35NO6 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | methyl 4-[5-[(E)-2-(4-hexanoyl-2-phenyl-1,3-oxazol-5-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
| SMILES | CCCCCC(=O)c1nc(-c2ccccc2)oc1/C=C/C1OC(C)(C)OC1CCCC(=O)OC |
| InChI | InChI=1S/C27H35NO6/c1-5-6-8-14-20(29)25-23(32-26(28-25)19-12-9-7-10-13-19)18-17-22-21(33-27(2,3)34-22)15-11-16-24(30)31-4/h7,9-10,12-13,17-18,21-22H,5-6,8,11,14-16H2,1-4H3/b18-17+ |
| InChIKey | RJESQNUFXLMRFB-ISLYRVAYSA-N |
| XLogP | 5.98 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|