C19H24N2O5 — CID 11595643
ethyl 5-[(6-methoxy-6-oxohexyl)amino]-2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 11595643) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl 5-[(6-methoxy-6-oxohexyl)amino]-2-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-[(6-methoxy-6-oxohexyl)amino]-2-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11595643 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | ethyl 5-[(6-methoxy-6-oxohexyl)amino]-2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccccc2)oc1NCCCCCC(=O)OC |
| InChI | InChI=1S/C19H24N2O5/c1-3-25-19(23)16-18(20-13-9-5-8-12-15(22)24-2)26-17(21-16)14-10-6-4-7-11-14/h4,6-7,10-11,20H,3,5,8-9,12-13H2,1-2H3 |
| InChIKey | JXTFIRFCCHINCK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|