C26H38O5 — CID 135066312
[(E,3S)-1-[3-(8-methoxy-8-oxooctyl)oxiran-2-yl]oct-1-en-3-yl] benzoate (PubChem CID 135066312) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is [(E,3S)-1-[3-(8-methoxy-8-oxooctyl)oxiran-2-yl]oct-1-en-3-yl] benzoate.
| Compound Name | [(E,3S)-1-[3-(8-methoxy-8-oxooctyl)oxiran-2-yl]oct-1-en-3-yl] benzoate |
|---|---|
| PubChem CID | 135066312 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | [(E,3S)-1-[3-(8-methoxy-8-oxooctyl)oxiran-2-yl]oct-1-en-3-yl] benzoate |
| SMILES | CCCCC[C@@H](/C=C/C1OC1CCCCCCCC(=O)OC)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H38O5/c1-3-4-9-16-22(30-26(28)21-14-10-8-11-15-21)19-20-24-23(31-24)17-12-6-5-7-13-18-25(27)29-2/h8,10-11,14-15,19-20,22-24H,3-7,9,12-13,16-18H2,1-2H3/b20-19+/t22-,23?,24?/m0/s1 |
| InChIKey | UDLGTNXIKURGGZ-QOGHBBRISA-N |
| XLogP | 6.02 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|