C24H40O5 — CID 11015057
methyl (5Z,8S,9E)-10-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-8-hydroxydeca-5,9-dienoate (PubChem CID 11015057) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is methyl (5Z,8S,9E)-10-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-8-hydroxydeca-5,9-dienoate.
| Compound Name | methyl (5Z,8S,9E)-10-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-8-hydroxydeca-5,9-dienoate |
|---|---|
| PubChem CID | 11015057 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | methyl (5Z,8S,9E)-10-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-8-hydroxydeca-5,9-dienoate |
| SMILES | CCCCC/C=C\C[C@@H]1OC(C)(C)O[C@@H]1/C=C/[C@@H](O)C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C24H40O5/c1-5-6-7-8-9-13-16-21-22(29-24(2,3)28-21)19-18-20(25)15-12-10-11-14-17-23(26)27-4/h9-10,12-13,18-22,25H,5-8,11,14-17H2,1-4H3/b12-10-,13-9-,19-18+/t20-,21-,22+/m0/s1 |
| InChIKey | NXYMXFDPXFFOFD-SGFRCOKZSA-N |
| XLogP | 5.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|