C20H33BO6 — CID 168990684
methyl (Z)-6-[2,2-dimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-dioxolan-4-yl]hex-4-enoate (PubChem CID 168990684) has the molecular formula C20H33BO6 and a molecular weight of 380.29 g/mol. Its IUPAC name is methyl (Z)-6-[2,2-dimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-dioxolan-4-yl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[2,2-dimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-dioxolan-4-yl]hex-4-enoate |
|---|---|
| PubChem CID | 168990684 |
| Molecular Formula | C20H33BO6 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | methyl (Z)-6-[2,2-dimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-dioxolan-4-yl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\CC1OC(C)(C)OC1/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H33BO6/c1-18(2)19(3,4)27-21(26-18)14-13-16-15(24-20(5,6)25-16)11-9-8-10-12-17(22)23-7/h8-9,13-16H,10-12H2,1-7H3/b9-8-,14-13+ |
| InChIKey | PDISGVKZEYLWLH-NRSBDZSJSA-N |
| XLogP | 3.59 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|