C13H23BO4 — CID 174052207
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoic acid (PubChem CID 174052207) has the molecular formula C13H23BO4 and a molecular weight of 254.13 g/mol. Its IUPAC name is 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoic acid.
| Compound Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoic acid |
|---|---|
| PubChem CID | 174052207 |
| Molecular Formula | C13H23BO4 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoic acid |
| SMILES | CC1(C)OB(C=CCCCCC(=O)O)OC1(C)C |
| InChI | InChI=1S/C13H23BO4/c1-12(2)13(3,4)18-14(17-12)10-8-6-5-7-9-11(15)16/h8,10H,5-7,9H2,1-4H3,(H,15,16) |
| InChIKey | PGPZIMJUTZRSNB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|