C20H39BO5Si — CID 174052210
(E)-6-[tert-butyl(dimethyl)silyl]oxy-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-7-enoic acid (PubChem CID 174052210) has the molecular formula C20H39BO5Si and a molecular weight of 398.43 g/mol. Its IUPAC name is (E)-6-[tert-butyl(dimethyl)silyl]oxy-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-7-enoic acid.
| Compound Name | (E)-6-[tert-butyl(dimethyl)silyl]oxy-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-7-enoic acid |
|---|---|
| PubChem CID | 174052210 |
| Molecular Formula | C20H39BO5Si |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (E)-6-[tert-butyl(dimethyl)silyl]oxy-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-7-enoic acid |
| SMILES | CC1(C)OB(/C=C/C(CCCCC(=O)O)O[Si](C)(C)C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C20H39BO5Si/c1-18(2,3)27(8,9)24-16(12-10-11-13-17(22)23)14-15-21-25-19(4,5)20(6,7)26-21/h14-16H,10-13H2,1-9H3,(H,22,23)/b15-14+ |
| InChIKey | XJLVYCSRKINHFK-CCEZHUSRSA-N |
| XLogP | 5.21 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|