C16H33IOSi — CID 22768571
tert-butyl-[(E)-1-iodo-7,7-dimethyloct-1-en-3-yl]oxy-dimethylsilane (PubChem CID 22768571) has the molecular formula C16H33IOSi and a molecular weight of 396.43 g/mol. Its IUPAC name is tert-butyl-[(E)-1-iodo-7,7-dimethyloct-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E)-1-iodo-7,7-dimethyloct-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 22768571 |
| Molecular Formula | C16H33IOSi |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | tert-butyl-[(E)-1-iodo-7,7-dimethyloct-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)CCCC(/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33IOSi/c1-15(2,3)12-9-10-14(11-13-17)18-19(7,8)16(4,5)6/h11,13-14H,9-10,12H2,1-8H3/b13-11+ |
| InChIKey | SEVCZMHICINAFN-ACCUITESSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|