C23H43IO2Si2 — CID 122400653
tert-butyl-[(E,1S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-iodoethenyl]non-5-en-3-ynoxy]-dimethylsilane (PubChem CID 122400653) has the molecular formula C23H43IO2Si2 and a molecular weight of 534.67 g/mol. Its IUPAC name is tert-butyl-[(E,1S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-iodoethenyl]non-5-en-3-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-iodoethenyl]non-5-en-3-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 122400653 |
| Molecular Formula | C23H43IO2Si2 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | tert-butyl-[(E,1S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-iodoethenyl]non-5-en-3-ynoxy]-dimethylsilane |
| SMILES | CC[C@@H](/C=C/C#CC[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H43IO2Si2/c1-12-20(25-27(8,9)22(2,3)4)16-14-13-15-17-21(18-19-24)26-28(10,11)23(5,6)7/h14,16,18-21H,12,17H2,1-11H3/b16-14+,19-18+/t20-,21-/m0/s1 |
| InChIKey | NKEIMVXNVPNSNP-FNFUUVTOSA-N |
| XLogP | 8.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|