tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen

C11H30OSi — CID 175100098

IUPACtert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen
SMILESCCC(CC)O[Si](C)(C)C(C)(C)C.[H][H].[H][H]
InChIInChI=1S/C11H26OSi.2H2/c1-8-10(9-2)12-13(6,7)11(3,4)5;;/h10H,8-9H2,1-7H3;2*1H
InChIKeyOETGLIJTEGELOY-UHFFFAOYSA-N
MW206.45 g/mol
LogP4.69
Rot. Bonds4

About tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen

tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen (PubChem CID 175100098) has the molecular formula C11H30OSi and a molecular weight of 206.45 g/mol. Its IUPAC name is tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen.

Molecular Properties

Compound Nametert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen
PubChem CID175100098
Molecular FormulaC11H30OSi
Molecular Weight206.45 g/mol
Exact Mass206.21
IUPAC Nametert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen
SMILESCCC(CC)O[Si](C)(C)C(C)(C)C.[H][H].[H][H]
InChIInChI=1S/C11H26OSi.2H2/c1-8-10(9-2)12-13(6,7)11(3,4)5;;/h10H,8-9H2,1-7H3;2*1H
InChIKeyOETGLIJTEGELOY-UHFFFAOYSA-N
XLogP4.69
TPSA9.23 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.45
LogP ≤ 54.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen?
The IUPAC name of tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen (CID 175100098) is tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen.
What is the SMILES notation for tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen?
The canonical SMILES for tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen is CCC(CC)O[Si](C)(C)C(C)(C)C.[H][H].[H][H].
What is the InChIKey of tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen?
The InChIKey is OETGLIJTEGELOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26OSi.2H2/c1-8-10(9-2)12-13(6,7)11(3,4)5;;/h10H,8-9H2,1-7H3;2*1H.
What are the key properties of tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen?
tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen has a molecular weight of 206.45 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-pentan-3-yloxysilane;molecular hydrogen is sourced from PubChem (CID 175100098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).