C13H27IO2Si — CID 102051822
tert-butyl-[(2R)-1-[(2R,3S)-3-(iodomethyl)oxiran-2-yl]butan-2-yl]oxy-dimethylsilane (PubChem CID 102051822) has the molecular formula C13H27IO2Si and a molecular weight of 370.35 g/mol. Its IUPAC name is tert-butyl-[(2R)-1-[(2R,3S)-3-(iodomethyl)oxiran-2-yl]butan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-1-[(2R,3S)-3-(iodomethyl)oxiran-2-yl]butan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102051822 |
| Molecular Formula | C13H27IO2Si |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | tert-butyl-[(2R)-1-[(2R,3S)-3-(iodomethyl)oxiran-2-yl]butan-2-yl]oxy-dimethylsilane |
| SMILES | CC[C@H](C[C@H]1O[C@@H]1CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27IO2Si/c1-7-10(8-11-12(9-14)15-11)16-17(5,6)13(2,3)4/h10-12H,7-9H2,1-6H3/t10-,11-,12-/m1/s1 |
| InChIKey | FCSQLBOJXGJDBV-IJLUTSLNSA-N |
| XLogP | 4.38 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|