C25H50O5Si2 — CID 174135176
(4S,5S)-5-[2-[(2R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxybutyl]oxiran-2-yl]-1-triethylsilyloxyethyl]-4-methyloxolan-2-one (PubChem CID 174135176) has the molecular formula C25H50O5Si2 and a molecular weight of 486.84 g/mol. Its IUPAC name is (4S,5S)-5-[2-[(2R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxybutyl]oxiran-2-yl]-1-triethylsilyloxyethyl]-4-methyloxolan-2-one.
| Compound Name | (4S,5S)-5-[2-[(2R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxybutyl]oxiran-2-yl]-1-triethylsilyloxyethyl]-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 174135176 |
| Molecular Formula | C25H50O5Si2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | (4S,5S)-5-[2-[(2R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxybutyl]oxiran-2-yl]-1-triethylsilyloxyethyl]-4-methyloxolan-2-one |
| SMILES | CC[C@@H](CC1O[C@@H]1CC(O[Si](CC)(CC)CC)[C@H]1OC(=O)C[C@@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O5Si2/c1-11-19(29-31(9,10)25(6,7)8)16-20-21(27-20)17-22(24-18(5)15-23(26)28-24)30-32(12-2,13-3)14-4/h18-22,24H,11-17H2,1-10H3/t18-,19-,20?,21+,22?,24-/m0/s1 |
| InChIKey | OKCYDRJVIWTSEX-DNZKTUSWSA-N |
| XLogP | 6.68 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|