C12H23BrO3Si — CID 100999051
(5S)-5-[(1S)-2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one (PubChem CID 100999051) has the molecular formula C12H23BrO3Si and a molecular weight of 323.30 g/mol. Its IUPAC name is (5S)-5-[(1S)-2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one.
| Compound Name | (5S)-5-[(1S)-2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one |
|---|---|
| PubChem CID | 100999051 |
| Molecular Formula | C12H23BrO3Si |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (5S)-5-[(1S)-2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CBr)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C12H23BrO3Si/c1-12(2,3)17(4,5)16-10(8-13)9-6-7-11(14)15-9/h9-10H,6-8H2,1-5H3/t9-,10+/m0/s1 |
| InChIKey | DTWCYAFYPUNCJW-VHSXEESVSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|